C16H12N8O5 — CID 23482039
3-nitro-N'-[5-nitro-6-(pyridin-4-ylamino)pyrimidin-4-yl]benzohydrazide (PubChem CID 23482039) has the molecular formula C16H12N8O5 and a molecular weight of 396.32 g/mol. Its IUPAC name is 3-nitro-N'-[5-nitro-6-(pyridin-4-ylamino)pyrimidin-4-yl]benzohydrazide.
| Compound Name | 3-nitro-N'-[5-nitro-6-(pyridin-4-ylamino)pyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 23482039 |
| Molecular Formula | C16H12N8O5 |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 3-nitro-N'-[5-nitro-6-(pyridin-4-ylamino)pyrimidin-4-yl]benzohydrazide |
| SMILES | O=C(NNc1ncnc(Nc2ccncc2)c1[N+](=O)[O-])c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H12N8O5/c25-16(10-2-1-3-12(8-10)23(26)27)22-21-15-13(24(28)29)14(18-9-19-15)20-11-4-6-17-7-5-11/h1-9H,(H,22,25)(H2,17,18,19,20,21) |
| InChIKey | TZFKWZWGLXRFCL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 178.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|