C17H14N8O5 — CID 23480901
N'-[6-[(6-methyl-2-pyridinyl)amino]-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide (PubChem CID 23480901) has the molecular formula C17H14N8O5 and a molecular weight of 410.35 g/mol. Its IUPAC name is N'-[6-[(6-methyl-2-pyridinyl)amino]-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide.
| Compound Name | N'-[6-[(6-methyl-2-pyridinyl)amino]-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 23480901 |
| Molecular Formula | C17H14N8O5 |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | N'-[6-[(6-methyl-2-pyridinyl)amino]-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide |
| SMILES | Cc1cccc(Nc2ncnc(NNC(=O)c3cccc([N+](=O)[O-])c3)c2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C17H14N8O5/c1-10-4-2-7-13(20-10)21-15-14(25(29)30)16(19-9-18-15)22-23-17(26)11-5-3-6-12(8-11)24(27)28/h2-9H,1H3,(H,23,26)(H2,18,19,20,21,22) |
| InChIKey | QUXZPFUBROAWMF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 178.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|