C19H15N7O7 — CID 22528811
methyl 2-[[5-nitro-6-[2-(3-nitrobenzoyl)hydrazinyl]pyrimidin-4-yl]amino]benzoate (PubChem CID 22528811) has the molecular formula C19H15N7O7 and a molecular weight of 453.37 g/mol. Its IUPAC name is methyl 2-[[5-nitro-6-[2-(3-nitrobenzoyl)hydrazinyl]pyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 2-[[5-nitro-6-[2-(3-nitrobenzoyl)hydrazinyl]pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 22528811 |
| Molecular Formula | C19H15N7O7 |
| Molecular Weight | 453.37 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | methyl 2-[[5-nitro-6-[2-(3-nitrobenzoyl)hydrazinyl]pyrimidin-4-yl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1Nc1ncnc(NNC(=O)c2cccc([N+](=O)[O-])c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H15N7O7/c1-33-19(28)13-7-2-3-8-14(13)22-16-15(26(31)32)17(21-10-20-16)23-24-18(27)11-5-4-6-12(9-11)25(29)30/h2-10H,1H3,(H,24,27)(H2,20,21,22,23) |
| InChIKey | PPWNGHMWRDETJG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 191.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|