C19H14ClN7O7 — CID 22528814
methyl 2-[[6-[2-(4-chloro-3-nitrobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzoate (PubChem CID 22528814) has the molecular formula C19H14ClN7O7 and a molecular weight of 487.82 g/mol. Its IUPAC name is methyl 2-[[6-[2-(4-chloro-3-nitrobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 2-[[6-[2-(4-chloro-3-nitrobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 22528814 |
| Molecular Formula | C19H14ClN7O7 |
| Molecular Weight | 487.82 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | methyl 2-[[6-[2-(4-chloro-3-nitrobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1Nc1ncnc(NNC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H14ClN7O7/c1-34-19(29)11-4-2-3-5-13(11)23-16-15(27(32)33)17(22-9-21-16)24-25-18(28)10-6-7-12(20)14(8-10)26(30)31/h2-9H,1H3,(H,25,28)(H2,21,22,23,24) |
| InChIKey | PZXVJULOSZTRCW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 191.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.82 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|