C20H13ClN8O5 — CID 22536262
4-chloro-3-nitro-N'-[5-nitro-6-(quinolin-5-ylamino)pyrimidin-4-yl]benzohydrazide (PubChem CID 22536262) has the molecular formula C20H13ClN8O5 and a molecular weight of 480.83 g/mol. Its IUPAC name is 4-chloro-3-nitro-N'-[5-nitro-6-(quinolin-5-ylamino)pyrimidin-4-yl]benzohydrazide.
| Compound Name | 4-chloro-3-nitro-N'-[5-nitro-6-(quinolin-5-ylamino)pyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 22536262 |
| Molecular Formula | C20H13ClN8O5 |
| Molecular Weight | 480.83 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 4-chloro-3-nitro-N'-[5-nitro-6-(quinolin-5-ylamino)pyrimidin-4-yl]benzohydrazide |
| SMILES | O=C(NNc1ncnc(Nc2cccc3ncccc23)c1[N+](=O)[O-])c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H13ClN8O5/c21-13-7-6-11(9-16(13)28(31)32)20(30)27-26-19-17(29(33)34)18(23-10-24-19)25-15-5-1-4-14-12(15)3-2-8-22-14/h1-10H,(H,27,30)(H2,23,24,25,26) |
| InChIKey | LSOTUVGQBHKLNI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 178.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.83 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|