C19H15ClN8O7 — CID 22536245
4-chloro-N'-[6-[2-(4-methoxybenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide (PubChem CID 22536245) has the molecular formula C19H15ClN8O7 and a molecular weight of 502.83 g/mol. Its IUPAC name is 4-chloro-N'-[6-[2-(4-methoxybenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide.
| Compound Name | 4-chloro-N'-[6-[2-(4-methoxybenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 22536245 |
| Molecular Formula | C19H15ClN8O7 |
| Molecular Weight | 502.83 g/mol |
| Exact Mass | 502.08 |
| IUPAC Name | 4-chloro-N'-[6-[2-(4-methoxybenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide |
| SMILES | COc1ccc(C(=O)NNc2ncnc(NNC(=O)c3ccc(Cl)c([N+](=O)[O-])c3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H15ClN8O7/c1-35-12-5-2-10(3-6-12)18(29)25-23-16-15(28(33)34)17(22-9-21-16)24-26-19(30)11-4-7-13(20)14(8-11)27(31)32/h2-9H,1H3,(H,25,29)(H,26,30)(H2,21,22,23,24) |
| InChIKey | GENFEQMTPYGIRX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 203.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.83 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|