C20H18ClN5O5 — CID 22536493
N'-[6-(4-chloro-3,5-dimethylphenoxy)-5-nitropyrimidin-4-yl]-4-methoxybenzohydrazide (PubChem CID 22536493) has the molecular formula C20H18ClN5O5 and a molecular weight of 443.85 g/mol. Its IUPAC name is N'-[6-(4-chloro-3,5-dimethylphenoxy)-5-nitropyrimidin-4-yl]-4-methoxybenzohydrazide.
| Compound Name | N'-[6-(4-chloro-3,5-dimethylphenoxy)-5-nitropyrimidin-4-yl]-4-methoxybenzohydrazide |
|---|---|
| PubChem CID | 22536493 |
| Molecular Formula | C20H18ClN5O5 |
| Molecular Weight | 443.85 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | N'-[6-(4-chloro-3,5-dimethylphenoxy)-5-nitropyrimidin-4-yl]-4-methoxybenzohydrazide |
| SMILES | COc1ccc(C(=O)NNc2ncnc(Oc3cc(C)c(Cl)c(C)c3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H18ClN5O5/c1-11-8-15(9-12(2)16(11)21)31-20-17(26(28)29)18(22-10-23-20)24-25-19(27)13-4-6-14(30-3)7-5-13/h4-10H,1-3H3,(H,25,27)(H,22,23,24) |
| InChIKey | QMGRMNZDTTWOSF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.85 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|