C22H19ClN4O7 — CID 23486404
dimethyl 5-[[6-(4-chloro-3,5-dimethylphenoxy)-5-nitropyrimidin-4-yl]amino]benzene-1,3-dicarboxylate (PubChem CID 23486404) has the molecular formula C22H19ClN4O7 and a molecular weight of 486.87 g/mol. Its IUPAC name is dimethyl 5-[[6-(4-chloro-3,5-dimethylphenoxy)-5-nitropyrimidin-4-yl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[6-(4-chloro-3,5-dimethylphenoxy)-5-nitropyrimidin-4-yl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 23486404 |
| Molecular Formula | C22H19ClN4O7 |
| Molecular Weight | 486.87 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | dimethyl 5-[[6-(4-chloro-3,5-dimethylphenoxy)-5-nitropyrimidin-4-yl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(Nc2ncnc(Oc3cc(C)c(Cl)c(C)c3)c2[N+](=O)[O-])cc(C(=O)OC)c1 |
| InChI | InChI=1S/C22H19ClN4O7/c1-11-5-16(6-12(2)17(11)23)34-20-18(27(30)31)19(24-10-25-20)26-15-8-13(21(28)32-3)7-14(9-15)22(29)33-4/h5-10H,1-4H3,(H,24,25,26) |
| InChIKey | UYHJMSXKWHFDBF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 142.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.87 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|