C18H14ClN5O5 — CID 22532778
6-(4-chloro-3,5-dimethylphenoxy)-5-nitro-N-(3-nitrophenyl)pyrimidin-4-amine (PubChem CID 22532778) has the molecular formula C18H14ClN5O5 and a molecular weight of 415.79 g/mol. Its IUPAC name is 6-(4-chloro-3,5-dimethylphenoxy)-5-nitro-N-(3-nitrophenyl)pyrimidin-4-amine.
| Compound Name | 6-(4-chloro-3,5-dimethylphenoxy)-5-nitro-N-(3-nitrophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 22532778 |
| Molecular Formula | C18H14ClN5O5 |
| Molecular Weight | 415.79 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | 6-(4-chloro-3,5-dimethylphenoxy)-5-nitro-N-(3-nitrophenyl)pyrimidin-4-amine |
| SMILES | Cc1cc(Oc2ncnc(Nc3cccc([N+](=O)[O-])c3)c2[N+](=O)[O-])cc(C)c1Cl |
| InChI | InChI=1S/C18H14ClN5O5/c1-10-6-14(7-11(2)15(10)19)29-18-16(24(27)28)17(20-9-21-18)22-12-4-3-5-13(8-12)23(25)26/h3-9H,1-2H3,(H,20,21,22) |
| InChIKey | VPZSRCXXDTUHAU-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.79 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|