C18H13ClF2N4O3 — CID 22537981
6-(4-chloro-3,5-dimethylphenoxy)-N-(2,5-difluorophenyl)-5-nitropyrimidin-4-amine (PubChem CID 22537981) has the molecular formula C18H13ClF2N4O3 and a molecular weight of 406.78 g/mol. Its IUPAC name is 6-(4-chloro-3,5-dimethylphenoxy)-N-(2,5-difluorophenyl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-(4-chloro-3,5-dimethylphenoxy)-N-(2,5-difluorophenyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22537981 |
| Molecular Formula | C18H13ClF2N4O3 |
| Molecular Weight | 406.78 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 6-(4-chloro-3,5-dimethylphenoxy)-N-(2,5-difluorophenyl)-5-nitropyrimidin-4-amine |
| SMILES | Cc1cc(Oc2ncnc(Nc3cc(F)ccc3F)c2[N+](=O)[O-])cc(C)c1Cl |
| InChI | InChI=1S/C18H13ClF2N4O3/c1-9-5-12(6-10(2)15(9)19)28-18-16(25(26)27)17(22-8-23-18)24-14-7-11(20)3-4-13(14)21/h3-8H,1-2H3,(H,22,23,24) |
| InChIKey | YFVICEQDJXLREF-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.78 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|