C18H14F2N4O3 — CID 22538651
N-(2,5-difluorophenyl)-6-(3,4-dimethylphenoxy)-5-nitropyrimidin-4-amine (PubChem CID 22538651) has the molecular formula C18H14F2N4O3 and a molecular weight of 372.33 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-6-(3,4-dimethylphenoxy)-5-nitropyrimidin-4-amine.
| Compound Name | N-(2,5-difluorophenyl)-6-(3,4-dimethylphenoxy)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22538651 |
| Molecular Formula | C18H14F2N4O3 |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | N-(2,5-difluorophenyl)-6-(3,4-dimethylphenoxy)-5-nitropyrimidin-4-amine |
| SMILES | Cc1ccc(Oc2ncnc(Nc3cc(F)ccc3F)c2[N+](=O)[O-])cc1C |
| InChI | InChI=1S/C18H14F2N4O3/c1-10-3-5-13(7-11(10)2)27-18-16(24(25)26)17(21-9-22-18)23-15-8-12(19)4-6-14(15)20/h3-9H,1-2H3,(H,21,22,23) |
| InChIKey | QXWHXCAUGRDIRA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|