C18H12F2N4O5 — CID 23483429
methyl 4-[6-(2,4-difluoroanilino)-5-nitropyrimidin-4-yl]oxybenzoate (PubChem CID 23483429) has the molecular formula C18H12F2N4O5 and a molecular weight of 402.31 g/mol. Its IUPAC name is methyl 4-[6-(2,4-difluoroanilino)-5-nitropyrimidin-4-yl]oxybenzoate.
| Compound Name | methyl 4-[6-(2,4-difluoroanilino)-5-nitropyrimidin-4-yl]oxybenzoate |
|---|---|
| PubChem CID | 23483429 |
| Molecular Formula | C18H12F2N4O5 |
| Molecular Weight | 402.31 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | methyl 4-[6-(2,4-difluoroanilino)-5-nitropyrimidin-4-yl]oxybenzoate |
| SMILES | COC(=O)c1ccc(Oc2ncnc(Nc3ccc(F)cc3F)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H12F2N4O5/c1-28-18(25)10-2-5-12(6-3-10)29-17-15(24(26)27)16(21-9-22-17)23-14-7-4-11(19)8-13(14)20/h2-9H,1H3,(H,21,22,23) |
| InChIKey | CIKHPYQGXYYWCH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.31 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|