C19H14ClN5O6 — CID 23483374
methyl 4-[6-[2-(4-chlorobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]oxybenzoate (PubChem CID 23483374) has the molecular formula C19H14ClN5O6 and a molecular weight of 443.80 g/mol. Its IUPAC name is methyl 4-[6-[2-(4-chlorobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]oxybenzoate.
| Compound Name | methyl 4-[6-[2-(4-chlorobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]oxybenzoate |
|---|---|
| PubChem CID | 23483374 |
| Molecular Formula | C19H14ClN5O6 |
| Molecular Weight | 443.80 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | methyl 4-[6-[2-(4-chlorobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]oxybenzoate |
| SMILES | COC(=O)c1ccc(Oc2ncnc(NNC(=O)c3ccc(Cl)cc3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H14ClN5O6/c1-30-19(27)12-4-8-14(9-5-12)31-18-15(25(28)29)16(21-10-22-18)23-24-17(26)11-2-6-13(20)7-3-11/h2-10H,1H3,(H,24,26)(H,21,22,23) |
| InChIKey | FPYGGXNICNIFSM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.80 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|