C16H12N6O4 — CID 22536554
N'-(5-nitro-6-phenoxypyrimidin-4-yl)pyridine-4-carbohydrazide (PubChem CID 22536554) has the molecular formula C16H12N6O4 and a molecular weight of 352.31 g/mol. Its IUPAC name is N'-(5-nitro-6-phenoxypyrimidin-4-yl)pyridine-4-carbohydrazide.
| Compound Name | N'-(5-nitro-6-phenoxypyrimidin-4-yl)pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 22536554 |
| Molecular Formula | C16H12N6O4 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | N'-(5-nitro-6-phenoxypyrimidin-4-yl)pyridine-4-carbohydrazide |
| SMILES | O=C(NNc1ncnc(Oc2ccccc2)c1[N+](=O)[O-])c1ccncc1 |
| InChI | InChI=1S/C16H12N6O4/c23-15(11-6-8-17-9-7-11)21-20-14-13(22(24)25)16(19-10-18-14)26-12-4-2-1-3-5-12/h1-10H,(H,21,23)(H,18,19,20) |
| InChIKey | UCAWQTAFCNFBSW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 132.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|