C22H18N8O3 — CID 22530692
N'-[6-(2,2-diphenylhydrazinyl)-5-nitropyrimidin-4-yl]pyridine-4-carbohydrazide (PubChem CID 22530692) has the molecular formula C22H18N8O3 and a molecular weight of 442.44 g/mol. Its IUPAC name is N'-[6-(2,2-diphenylhydrazinyl)-5-nitropyrimidin-4-yl]pyridine-4-carbohydrazide.
| Compound Name | N'-[6-(2,2-diphenylhydrazinyl)-5-nitropyrimidin-4-yl]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 22530692 |
| Molecular Formula | C22H18N8O3 |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | N'-[6-(2,2-diphenylhydrazinyl)-5-nitropyrimidin-4-yl]pyridine-4-carbohydrazide |
| SMILES | O=C(NNc1ncnc(NN(c2ccccc2)c2ccccc2)c1[N+](=O)[O-])c1ccncc1 |
| InChI | InChI=1S/C22H18N8O3/c31-22(16-11-13-23-14-12-16)27-26-20-19(30(32)33)21(25-15-24-20)28-29(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-15H,(H,27,31)(H2,24,25,26,28) |
| InChIKey | ODSWHXGDVLQBJT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 138.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|