C18H19N7O2 — CID 22528078
2-[6-(2,2-dimethylhydrazinyl)-5-nitropyrimidin-4-yl]-1,1-diphenylhydrazine (PubChem CID 22528078) has the molecular formula C18H19N7O2 and a molecular weight of 365.40 g/mol. Its IUPAC name is 2-[6-(2,2-dimethylhydrazinyl)-5-nitropyrimidin-4-yl]-1,1-diphenylhydrazine.
| Compound Name | 2-[6-(2,2-dimethylhydrazinyl)-5-nitropyrimidin-4-yl]-1,1-diphenylhydrazine |
|---|---|
| PubChem CID | 22528078 |
| Molecular Formula | C18H19N7O2 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 2-[6-(2,2-dimethylhydrazinyl)-5-nitropyrimidin-4-yl]-1,1-diphenylhydrazine |
| SMILES | CN(C)Nc1ncnc(NN(c2ccccc2)c2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H19N7O2/c1-23(2)21-17-16(25(26)27)18(20-13-19-17)22-24(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-13H,1-2H3,(H2,19,20,21,22) |
| InChIKey | FTNGCNNPZKGNSH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|