C22H16F2N6O2 — CID 22530733
N-(3,4-difluorophenyl)-6-(2,2-diphenylhydrazinyl)-5-nitropyrimidin-4-amine (PubChem CID 22530733) has the molecular formula C22H16F2N6O2 and a molecular weight of 434.41 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-6-(2,2-diphenylhydrazinyl)-5-nitropyrimidin-4-amine.
| Compound Name | N-(3,4-difluorophenyl)-6-(2,2-diphenylhydrazinyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22530733 |
| Molecular Formula | C22H16F2N6O2 |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | N-(3,4-difluorophenyl)-6-(2,2-diphenylhydrazinyl)-5-nitropyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(Nc2ccc(F)c(F)c2)ncnc1NN(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H16F2N6O2/c23-18-12-11-15(13-19(18)24)27-21-20(30(31)32)22(26-14-25-21)28-29(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-14H,(H2,25,26,27,28) |
| InChIKey | ZUCJGTHMTUVTDF-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|