C10H7F2N5O2 — CID 2960519
4-N-(3,4-difluorophenyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 2960519) has the molecular formula C10H7F2N5O2 and a molecular weight of 267.19 g/mol. Its IUPAC name is 4-N-(3,4-difluorophenyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-(3,4-difluorophenyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 2960519 |
| Molecular Formula | C10H7F2N5O2 |
| Molecular Weight | 267.19 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 4-N-(3,4-difluorophenyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | Nc1ncnc(Nc2ccc(F)c(F)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H7F2N5O2/c11-6-2-1-5(3-7(6)12)16-10-8(17(18)19)9(13)14-4-15-10/h1-4H,(H3,13,14,15,16) |
| InChIKey | JUCKXEKTPRZFGR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.19 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|