C10H8N6O4 — CID 4140408
5-nitro-4-N-(3-nitrophenyl)pyrimidine-4,6-diamine (PubChem CID 4140408) has the molecular formula C10H8N6O4 and a molecular weight of 276.21 g/mol. Its IUPAC name is 5-nitro-4-N-(3-nitrophenyl)pyrimidine-4,6-diamine.
| Compound Name | 5-nitro-4-N-(3-nitrophenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 4140408 |
| Molecular Formula | C10H8N6O4 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 5-nitro-4-N-(3-nitrophenyl)pyrimidine-4,6-diamine |
| SMILES | Nc1ncnc(Nc2cccc([N+](=O)[O-])c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H8N6O4/c11-9-8(16(19)20)10(13-5-12-9)14-6-2-1-3-7(4-6)15(17)18/h1-5H,(H3,11,12,13,14) |
| InChIKey | ONLYWYZZIVRFEM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 150.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|