C21H18N8O2 — CID 108775228
4-N-[3-[(2-methyl-6-phenylpyrimidin-4-yl)amino]phenyl]-5-nitropyrimidine-4,6-diamine (PubChem CID 108775228) has the molecular formula C21H18N8O2 and a molecular weight of 414.43 g/mol. Its IUPAC name is 4-N-[3-[(2-methyl-6-phenylpyrimidin-4-yl)amino]phenyl]-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-[3-[(2-methyl-6-phenylpyrimidin-4-yl)amino]phenyl]-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 108775228 |
| Molecular Formula | C21H18N8O2 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 4-N-[3-[(2-methyl-6-phenylpyrimidin-4-yl)amino]phenyl]-5-nitropyrimidine-4,6-diamine |
| SMILES | Cc1nc(Nc2cccc(Nc3ncnc(N)c3[N+](=O)[O-])c2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H18N8O2/c1-13-25-17(14-6-3-2-4-7-14)11-18(26-13)27-15-8-5-9-16(10-15)28-21-19(29(30)31)20(22)23-12-24-21/h2-12H,1H3,(H,25,26,27)(H3,22,23,24,28) |
| InChIKey | YWFCGKZPKLGXAU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 144.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|