C20H19N3O2 — CID 9149585
[3-[(2-methyl-6-phenylpyrimidin-4-yl)amino]phenyl] propanoate (PubChem CID 9149585) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is [3-[(2-methyl-6-phenylpyrimidin-4-yl)amino]phenyl] propanoate.
| Compound Name | [3-[(2-methyl-6-phenylpyrimidin-4-yl)amino]phenyl] propanoate |
|---|---|
| PubChem CID | 9149585 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | [3-[(2-methyl-6-phenylpyrimidin-4-yl)amino]phenyl] propanoate |
| SMILES | CCC(=O)Oc1cccc(Nc2cc(-c3ccccc3)nc(C)n2)c1 |
| InChI | InChI=1S/C20H19N3O2/c1-3-20(24)25-17-11-7-10-16(12-17)23-19-13-18(21-14(2)22-19)15-8-5-4-6-9-15/h4-13H,3H2,1-2H3,(H,21,22,23) |
| InChIKey | GZLCGTHSOFGXTK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|