C15H17N3O2S — CID 9148786
[3-[(6-methyl-2-methylsulfanylpyrimidin-4-yl)amino]phenyl] propanoate (PubChem CID 9148786) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is [3-[(6-methyl-2-methylsulfanylpyrimidin-4-yl)amino]phenyl] propanoate.
| Compound Name | [3-[(6-methyl-2-methylsulfanylpyrimidin-4-yl)amino]phenyl] propanoate |
|---|---|
| PubChem CID | 9148786 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | [3-[(6-methyl-2-methylsulfanylpyrimidin-4-yl)amino]phenyl] propanoate |
| SMILES | CCC(=O)Oc1cccc(Nc2cc(C)nc(SC)n2)c1 |
| InChI | InChI=1S/C15H17N3O2S/c1-4-14(19)20-12-7-5-6-11(9-12)17-13-8-10(2)16-15(18-13)21-3/h5-9H,4H2,1-3H3,(H,16,17,18) |
| InChIKey | RYEWSLXOHXXMMM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|