C17H19N3O5S — CID 9150252
ethyl 4-(3-ethoxycarbonyloxyanilino)-2-methylsulfanylpyrimidine-5-carboxylate (PubChem CID 9150252) has the molecular formula C17H19N3O5S and a molecular weight of 377.42 g/mol. Its IUPAC name is ethyl 4-(3-ethoxycarbonyloxyanilino)-2-methylsulfanylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(3-ethoxycarbonyloxyanilino)-2-methylsulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 9150252 |
| Molecular Formula | C17H19N3O5S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | ethyl 4-(3-ethoxycarbonyloxyanilino)-2-methylsulfanylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)Oc1cccc(Nc2nc(SC)ncc2C(=O)OCC)c1 |
| InChI | InChI=1S/C17H19N3O5S/c1-4-23-15(21)13-10-18-16(26-3)20-14(13)19-11-7-6-8-12(9-11)25-17(22)24-5-2/h6-10H,4-5H2,1-3H3,(H,18,19,20) |
| InChIKey | OVGVDXYSBGPRFV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|