C17H23N3O2S — CID 144591369
ethane;ethyl 4-(3-methylanilino)-2-methylsulfanylpyrimidine-5-carboxylate (PubChem CID 144591369) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is ethane;ethyl 4-(3-methylanilino)-2-methylsulfanylpyrimidine-5-carboxylate.
| Compound Name | ethane;ethyl 4-(3-methylanilino)-2-methylsulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 144591369 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | ethane;ethyl 4-(3-methylanilino)-2-methylsulfanylpyrimidine-5-carboxylate |
| SMILES | CC.CCOC(=O)c1cnc(SC)nc1Nc1cccc(C)c1 |
| InChI | InChI=1S/C15H17N3O2S.C2H6/c1-4-20-14(19)12-9-16-15(21-3)18-13(12)17-11-7-5-6-10(2)8-11;1-2/h5-9H,4H2,1-3H3,(H,16,17,18);1-2H3 |
| InChIKey | MJNXBPNGFXCOKN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |