C18H19N3O6S — CID 9151261
dimethyl 5-[(5-ethoxycarbonyl-2-methylsulfanylpyrimidin-4-yl)amino]benzene-1,3-dicarboxylate (PubChem CID 9151261) has the molecular formula C18H19N3O6S and a molecular weight of 405.43 g/mol. Its IUPAC name is dimethyl 5-[(5-ethoxycarbonyl-2-methylsulfanylpyrimidin-4-yl)amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[(5-ethoxycarbonyl-2-methylsulfanylpyrimidin-4-yl)amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 9151261 |
| Molecular Formula | C18H19N3O6S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | dimethyl 5-[(5-ethoxycarbonyl-2-methylsulfanylpyrimidin-4-yl)amino]benzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1cnc(SC)nc1Nc1cc(C(=O)OC)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C18H19N3O6S/c1-5-27-17(24)13-9-19-18(28-4)21-14(13)20-12-7-10(15(22)25-2)6-11(8-12)16(23)26-3/h6-9H,5H2,1-4H3,(H,19,20,21) |
| InChIKey | JOBOWVDCVUQIEM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 116.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|