C19H23N3O7S — CID 108776170
diethyl 2-[(5-ethoxycarbonyl-2-methylsulfanylpyrimidin-4-yl)amino]-5-methylfuran-3,4-dicarboxylate (PubChem CID 108776170) has the molecular formula C19H23N3O7S and a molecular weight of 437.47 g/mol. Its IUPAC name is diethyl 2-[(5-ethoxycarbonyl-2-methylsulfanylpyrimidin-4-yl)amino]-5-methylfuran-3,4-dicarboxylate.
| Compound Name | diethyl 2-[(5-ethoxycarbonyl-2-methylsulfanylpyrimidin-4-yl)amino]-5-methylfuran-3,4-dicarboxylate |
|---|---|
| PubChem CID | 108776170 |
| Molecular Formula | C19H23N3O7S |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | diethyl 2-[(5-ethoxycarbonyl-2-methylsulfanylpyrimidin-4-yl)amino]-5-methylfuran-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1cnc(SC)nc1Nc1oc(C)c(C(=O)OCC)c1C(=O)OCC |
| InChI | InChI=1S/C19H23N3O7S/c1-6-26-16(23)11-9-20-19(30-5)22-14(11)21-15-13(18(25)28-8-3)12(10(4)29-15)17(24)27-7-2/h9H,6-8H2,1-5H3,(H,20,21,22) |
| InChIKey | CNTLEIITMBNXNF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|