C11H17N3O3S — CID 59681435
ethyl 4-[[(2S)-2-hydroxypropyl]amino]-2-methylsulfanylpyrimidine-5-carboxylate (PubChem CID 59681435) has the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. Its IUPAC name is ethyl 4-[[(2S)-2-hydroxypropyl]amino]-2-methylsulfanylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[[(2S)-2-hydroxypropyl]amino]-2-methylsulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 59681435 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | ethyl 4-[[(2S)-2-hydroxypropyl]amino]-2-methylsulfanylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SC)nc1NC[C@H](C)O |
| InChI | InChI=1S/C11H17N3O3S/c1-4-17-10(16)8-6-13-11(18-3)14-9(8)12-5-7(2)15/h6-7,15H,4-5H2,1-3H3,(H,12,13,14)/t7-/m0/s1 |
| InChIKey | VRTUSMKPYYDARK-ZETCQYMHSA-N |
| XLogP | 1.17 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |