C16H23N3O2S — CID 9151289
ethyl 4-[2-(cyclohexen-1-yl)ethylamino]-2-methylsulfanylpyrimidine-5-carboxylate (PubChem CID 9151289) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is ethyl 4-[2-(cyclohexen-1-yl)ethylamino]-2-methylsulfanylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[2-(cyclohexen-1-yl)ethylamino]-2-methylsulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 9151289 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | ethyl 4-[2-(cyclohexen-1-yl)ethylamino]-2-methylsulfanylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SC)nc1NCCC1=CCCCC1 |
| InChI | InChI=1S/C16H23N3O2S/c1-3-21-15(20)13-11-18-16(22-2)19-14(13)17-10-9-12-7-5-4-6-8-12/h7,11H,3-6,8-10H2,1-2H3,(H,17,18,19) |
| InChIKey | HBWHULBWQBCNET-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|