C15H15FN4O3S — CID 20913925
ethyl 4-[(4-fluorophenyl)carbamoylamino]-2-methylsulfanylpyrimidine-5-carboxylate (PubChem CID 20913925) has the molecular formula C15H15FN4O3S and a molecular weight of 350.38 g/mol. Its IUPAC name is ethyl 4-[(4-fluorophenyl)carbamoylamino]-2-methylsulfanylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[(4-fluorophenyl)carbamoylamino]-2-methylsulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 20913925 |
| Molecular Formula | C15H15FN4O3S |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | ethyl 4-[(4-fluorophenyl)carbamoylamino]-2-methylsulfanylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SC)nc1NC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C15H15FN4O3S/c1-3-23-13(21)11-8-17-15(24-2)20-12(11)19-14(22)18-10-6-4-9(16)5-7-10/h4-8H,3H2,1-2H3,(H2,17,18,19,20,22) |
| InChIKey | GQLJTFQGZMWLGX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |