C15H20N2O2 — CID 60712823
methyl 2-[2-(cyclohexen-1-yl)ethylamino]pyridine-3-carboxylate (PubChem CID 60712823) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is methyl 2-[2-(cyclohexen-1-yl)ethylamino]pyridine-3-carboxylate.
| Compound Name | methyl 2-[2-(cyclohexen-1-yl)ethylamino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 60712823 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | methyl 2-[2-(cyclohexen-1-yl)ethylamino]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cccnc1NCCC1=CCCCC1 |
| InChI | InChI=1S/C15H20N2O2/c1-19-15(18)13-8-5-10-16-14(13)17-11-9-12-6-3-2-4-7-12/h5-6,8,10H,2-4,7,9,11H2,1H3,(H,16,17) |
| InChIKey | JIGNGZFOBZMZMG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|