C22H25N3O3 — CID 109183687
methyl 2-[[6-[2-(cyclohexen-1-yl)ethylcarbamoyl]-3-pyridinyl]amino]benzoate (PubChem CID 109183687) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is methyl 2-[[6-[2-(cyclohexen-1-yl)ethylcarbamoyl]-3-pyridinyl]amino]benzoate.
| Compound Name | methyl 2-[[6-[2-(cyclohexen-1-yl)ethylcarbamoyl]-3-pyridinyl]amino]benzoate |
|---|---|
| PubChem CID | 109183687 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | methyl 2-[[6-[2-(cyclohexen-1-yl)ethylcarbamoyl]-3-pyridinyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1Nc1ccc(C(=O)NCCC2=CCCCC2)nc1 |
| InChI | InChI=1S/C22H25N3O3/c1-28-22(27)18-9-5-6-10-19(18)25-17-11-12-20(24-15-17)21(26)23-14-13-16-7-3-2-4-8-16/h5-7,9-12,15,25H,2-4,8,13-14H2,1H3,(H,23,26) |
| InChIKey | GULGOGNGHHQTCI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|