C16H22N2O — CID 61377844
N-[2-(cyclohexen-1-yl)ethyl]-2-(methylamino)benzamide (PubChem CID 61377844) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-(methylamino)benzamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(methylamino)benzamide |
|---|---|
| PubChem CID | 61377844 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(methylamino)benzamide |
| SMILES | CNc1ccccc1C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C16H22N2O/c1-17-15-10-6-5-9-14(15)16(19)18-12-11-13-7-3-2-4-8-13/h5-7,9-10,17H,2-4,8,11-12H2,1H3,(H,18,19) |
| InChIKey | ZIKFFKNGEYCLSN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|