C17H24N2O3S — CID 56786800
N-[2-(cyclohexen-1-yl)ethyl]-2-[2-(methanesulfonamido)phenyl]acetamide (PubChem CID 56786800) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[2-(methanesulfonamido)phenyl]acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[2-(methanesulfonamido)phenyl]acetamide |
|---|---|
| PubChem CID | 56786800 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[2-(methanesulfonamido)phenyl]acetamide |
| SMILES | CS(=O)(=O)Nc1ccccc1CC(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C17H24N2O3S/c1-23(21,22)19-16-10-6-5-9-15(16)13-17(20)18-12-11-14-7-3-2-4-8-14/h5-7,9-10,19H,2-4,8,11-13H2,1H3,(H,18,20) |
| InChIKey | RRHWYMMVOSIWLB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|