C16H22N2O3S — CID 112991103
2-(benzenesulfonamido)-N-[2-(cyclohexen-1-yl)ethyl]acetamide (PubChem CID 112991103) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-[2-(cyclohexen-1-yl)ethyl]acetamide.
| Compound Name | 2-(benzenesulfonamido)-N-[2-(cyclohexen-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 112991103 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 2-(benzenesulfonamido)-N-[2-(cyclohexen-1-yl)ethyl]acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccccc1)NCCC1=CCCCC1 |
| InChI | InChI=1S/C16H22N2O3S/c19-16(17-12-11-14-7-3-1-4-8-14)13-18-22(20,21)15-9-5-2-6-10-15/h2,5-7,9-10,18H,1,3-4,8,11-13H2,(H,17,19) |
| InChIKey | CYECTJDTCOKQGC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|