C17H22F2N2O3S — CID 29261799
N-[2-(cyclohexen-1-yl)ethyl]-3-[(3,4-difluorophenyl)sulfonylamino]propanamide (PubChem CID 29261799) has the molecular formula C17H22F2N2O3S and a molecular weight of 372.44 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-3-[(3,4-difluorophenyl)sulfonylamino]propanamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-3-[(3,4-difluorophenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 29261799 |
| Molecular Formula | C17H22F2N2O3S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-3-[(3,4-difluorophenyl)sulfonylamino]propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccc(F)c(F)c1)NCCC1=CCCCC1 |
| InChI | InChI=1S/C17H22F2N2O3S/c18-15-7-6-14(12-16(15)19)25(23,24)21-11-9-17(22)20-10-8-13-4-2-1-3-5-13/h4,6-7,12,21H,1-3,5,8-11H2,(H,20,22) |
| InChIKey | IMQAPQSIGGKDGH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|