C22H31N3O4S — CID 92687792
3-[[(2S)-1-acetyl-2-methyl-2,3-dihydroindol-5-yl]sulfonylamino]-N-[2-(cyclohexen-1-yl)ethyl]propanamide (PubChem CID 92687792) has the molecular formula C22H31N3O4S and a molecular weight of 433.57 g/mol. Its IUPAC name is 3-[[(2S)-1-acetyl-2-methyl-2,3-dihydroindol-5-yl]sulfonylamino]-N-[2-(cyclohexen-1-yl)ethyl]propanamide.
| Compound Name | 3-[[(2S)-1-acetyl-2-methyl-2,3-dihydroindol-5-yl]sulfonylamino]-N-[2-(cyclohexen-1-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 92687792 |
| Molecular Formula | C22H31N3O4S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 3-[[(2S)-1-acetyl-2-methyl-2,3-dihydroindol-5-yl]sulfonylamino]-N-[2-(cyclohexen-1-yl)ethyl]propanamide |
| SMILES | CC(=O)N1c2ccc(S(=O)(=O)NCCC(=O)NCCC3=CCCCC3)cc2C[C@@H]1C |
| InChI | InChI=1S/C22H31N3O4S/c1-16-14-19-15-20(8-9-21(19)25(16)17(2)26)30(28,29)24-13-11-22(27)23-12-10-18-6-4-3-5-7-18/h6,8-9,15-16,24H,3-5,7,10-14H2,1-2H3,(H,23,27)/t16-/m0/s1 |
| InChIKey | WJTHUAAOSZCJGJ-INIZCTEOSA-N |
| XLogP | 2.66 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|