C23H30N4O4S — CID 92504991
3-[[(2R)-1-acetyl-2-methyl-2,3-dihydroindol-5-yl]sulfonylamino]-N-[[4-(dimethylamino)phenyl]methyl]propanamide (PubChem CID 92504991) has the molecular formula C23H30N4O4S and a molecular weight of 458.58 g/mol. Its IUPAC name is 3-[[(2R)-1-acetyl-2-methyl-2,3-dihydroindol-5-yl]sulfonylamino]-N-[[4-(dimethylamino)phenyl]methyl]propanamide.
| Compound Name | 3-[[(2R)-1-acetyl-2-methyl-2,3-dihydroindol-5-yl]sulfonylamino]-N-[[4-(dimethylamino)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 92504991 |
| Molecular Formula | C23H30N4O4S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 3-[[(2R)-1-acetyl-2-methyl-2,3-dihydroindol-5-yl]sulfonylamino]-N-[[4-(dimethylamino)phenyl]methyl]propanamide |
| SMILES | CC(=O)N1c2ccc(S(=O)(=O)NCCC(=O)NCc3ccc(N(C)C)cc3)cc2C[C@H]1C |
| InChI | InChI=1S/C23H30N4O4S/c1-16-13-19-14-21(9-10-22(19)27(16)17(2)28)32(30,31)25-12-11-23(29)24-15-18-5-7-20(8-6-18)26(3)4/h5-10,14,16,25H,11-13,15H2,1-4H3,(H,24,29)/t16-/m1/s1 |
| InChIKey | GFBZCJYNXQQMGJ-MRXNPFEDSA-N |
| XLogP | 2.03 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|