C11H14F2N2O3S — CID 47101447
3-[(3,4-difluorophenyl)sulfonylamino]-N-ethylpropanamide (PubChem CID 47101447) has the molecular formula C11H14F2N2O3S and a molecular weight of 292.31 g/mol. Its IUPAC name is 3-[(3,4-difluorophenyl)sulfonylamino]-N-ethylpropanamide.
| Compound Name | 3-[(3,4-difluorophenyl)sulfonylamino]-N-ethylpropanamide |
|---|---|
| PubChem CID | 47101447 |
| Molecular Formula | C11H14F2N2O3S |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 3-[(3,4-difluorophenyl)sulfonylamino]-N-ethylpropanamide |
| SMILES | CCNC(=O)CCNS(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H14F2N2O3S/c1-2-14-11(16)5-6-15-19(17,18)8-3-4-9(12)10(13)7-8/h3-4,7,15H,2,5-6H2,1H3,(H,14,16) |
| InChIKey | IUSKGMVYBQWPPA-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |