C15H21F2N3O4S — CID 46655347
2-[3-[(3,4-difluorophenyl)sulfonylamino]propanoylamino]-N-propylpropanamide (PubChem CID 46655347) has the molecular formula C15H21F2N3O4S and a molecular weight of 377.41 g/mol. Its IUPAC name is 2-[3-[(3,4-difluorophenyl)sulfonylamino]propanoylamino]-N-propylpropanamide.
| Compound Name | 2-[3-[(3,4-difluorophenyl)sulfonylamino]propanoylamino]-N-propylpropanamide |
|---|---|
| PubChem CID | 46655347 |
| Molecular Formula | C15H21F2N3O4S |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 2-[3-[(3,4-difluorophenyl)sulfonylamino]propanoylamino]-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)NC(=O)CCNS(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H21F2N3O4S/c1-3-7-18-15(22)10(2)20-14(21)6-8-19-25(23,24)11-4-5-12(16)13(17)9-11/h4-5,9-10,19H,3,6-8H2,1-2H3,(H,18,22)(H,20,21) |
| InChIKey | ZZULPBUSLDYTFG-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |