C12H16F2N2O3S — CID 24539448
3-[(3,4-difluorophenyl)sulfonylamino]-N-propan-2-ylpropanamide (PubChem CID 24539448) has the molecular formula C12H16F2N2O3S and a molecular weight of 306.33 g/mol. Its IUPAC name is 3-[(3,4-difluorophenyl)sulfonylamino]-N-propan-2-ylpropanamide.
| Compound Name | 3-[(3,4-difluorophenyl)sulfonylamino]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 24539448 |
| Molecular Formula | C12H16F2N2O3S |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 3-[(3,4-difluorophenyl)sulfonylamino]-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)CCNS(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H16F2N2O3S/c1-8(2)16-12(17)5-6-15-20(18,19)9-3-4-10(13)11(14)7-9/h3-4,7-8,15H,5-6H2,1-2H3,(H,16,17) |
| InChIKey | PMANINQCOPXTEV-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |