C18H19BrF2N2O3S — CID 43011602
N-[1-(4-bromophenyl)propyl]-3-[(3,4-difluorophenyl)sulfonylamino]propanamide (PubChem CID 43011602) has the molecular formula C18H19BrF2N2O3S and a molecular weight of 461.33 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)propyl]-3-[(3,4-difluorophenyl)sulfonylamino]propanamide.
| Compound Name | N-[1-(4-bromophenyl)propyl]-3-[(3,4-difluorophenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 43011602 |
| Molecular Formula | C18H19BrF2N2O3S |
| Molecular Weight | 461.33 g/mol |
| Exact Mass | 460.03 |
| IUPAC Name | N-[1-(4-bromophenyl)propyl]-3-[(3,4-difluorophenyl)sulfonylamino]propanamide |
| SMILES | CCC(NC(=O)CCNS(=O)(=O)c1ccc(F)c(F)c1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H19BrF2N2O3S/c1-2-17(12-3-5-13(19)6-4-12)23-18(24)9-10-22-27(25,26)14-7-8-15(20)16(21)11-14/h3-8,11,17,22H,2,9-10H2,1H3,(H,23,24) |
| InChIKey | HVWYZCONLRCDEQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.33 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |