C19H21BrN2O5S — CID 46657423
methyl 3-[3-[(4-bromophenyl)sulfonylamino]propanoylamino]-3-phenylpropanoate (PubChem CID 46657423) has the molecular formula C19H21BrN2O5S and a molecular weight of 469.36 g/mol. Its IUPAC name is methyl 3-[3-[(4-bromophenyl)sulfonylamino]propanoylamino]-3-phenylpropanoate.
| Compound Name | methyl 3-[3-[(4-bromophenyl)sulfonylamino]propanoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 46657423 |
| Molecular Formula | C19H21BrN2O5S |
| Molecular Weight | 469.36 g/mol |
| Exact Mass | 468.04 |
| IUPAC Name | methyl 3-[3-[(4-bromophenyl)sulfonylamino]propanoylamino]-3-phenylpropanoate |
| SMILES | COC(=O)CC(NC(=O)CCNS(=O)(=O)c1ccc(Br)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H21BrN2O5S/c1-27-19(24)13-17(14-5-3-2-4-6-14)22-18(23)11-12-21-28(25,26)16-9-7-15(20)8-10-16/h2-10,17,21H,11-13H2,1H3,(H,22,23) |
| InChIKey | ZWJYPQPPRDOOPH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |