C21H23ClN2O6S — CID 55439601
methyl 3-[3-[(4-acetylphenyl)sulfonylamino]propanoylamino]-3-(4-chlorophenyl)propanoate (PubChem CID 55439601) has the molecular formula C21H23ClN2O6S and a molecular weight of 466.94 g/mol. Its IUPAC name is methyl 3-[3-[(4-acetylphenyl)sulfonylamino]propanoylamino]-3-(4-chlorophenyl)propanoate.
| Compound Name | methyl 3-[3-[(4-acetylphenyl)sulfonylamino]propanoylamino]-3-(4-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 55439601 |
| Molecular Formula | C21H23ClN2O6S |
| Molecular Weight | 466.94 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | methyl 3-[3-[(4-acetylphenyl)sulfonylamino]propanoylamino]-3-(4-chlorophenyl)propanoate |
| SMILES | COC(=O)CC(NC(=O)CCNS(=O)(=O)c1ccc(C(C)=O)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H23ClN2O6S/c1-14(25)15-5-9-18(10-6-15)31(28,29)23-12-11-20(26)24-19(13-21(27)30-2)16-3-7-17(22)8-4-16/h3-10,19,23H,11-13H2,1-2H3,(H,24,26) |
| InChIKey | RVXAFNFBMLYZQG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.94 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |