C23H30N2O5S — CID 24554440
methyl 3-[3-[(4-tert-butylphenyl)sulfonylamino]propanoylamino]-3-phenylpropanoate (PubChem CID 24554440) has the molecular formula C23H30N2O5S and a molecular weight of 446.57 g/mol. Its IUPAC name is methyl 3-[3-[(4-tert-butylphenyl)sulfonylamino]propanoylamino]-3-phenylpropanoate.
| Compound Name | methyl 3-[3-[(4-tert-butylphenyl)sulfonylamino]propanoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 24554440 |
| Molecular Formula | C23H30N2O5S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | methyl 3-[3-[(4-tert-butylphenyl)sulfonylamino]propanoylamino]-3-phenylpropanoate |
| SMILES | COC(=O)CC(NC(=O)CCNS(=O)(=O)c1ccc(C(C)(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H30N2O5S/c1-23(2,3)18-10-12-19(13-11-18)31(28,29)24-15-14-21(26)25-20(16-22(27)30-4)17-8-6-5-7-9-17/h5-13,20,24H,14-16H2,1-4H3,(H,25,26) |
| InChIKey | FKGOJRHPKBZNJW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |