C15H21BrN2O5S — CID 99815138
ethyl (3S)-3-[3-[(4-bromophenyl)sulfonylamino]propanoylamino]butanoate (PubChem CID 99815138) has the molecular formula C15H21BrN2O5S and a molecular weight of 421.31 g/mol. Its IUPAC name is ethyl (3S)-3-[3-[(4-bromophenyl)sulfonylamino]propanoylamino]butanoate.
| Compound Name | ethyl (3S)-3-[3-[(4-bromophenyl)sulfonylamino]propanoylamino]butanoate |
|---|---|
| PubChem CID | 99815138 |
| Molecular Formula | C15H21BrN2O5S |
| Molecular Weight | 421.31 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | ethyl (3S)-3-[3-[(4-bromophenyl)sulfonylamino]propanoylamino]butanoate |
| SMILES | CCOC(=O)C[C@H](C)NC(=O)CCNS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H21BrN2O5S/c1-3-23-15(20)10-11(2)18-14(19)8-9-17-24(21,22)13-6-4-12(16)5-7-13/h4-7,11,17H,3,8-10H2,1-2H3,(H,18,19)/t11-/m0/s1 |
| InChIKey | PVDXDEUMMFXRMI-NSHDSACASA-N |
| XLogP | 1.58 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |