C20H24BrN3O4S — CID 33033362
N-[4-[3-[(4-bromophenyl)sulfonylamino]propanoylamino]phenyl]-3-methylbutanamide (PubChem CID 33033362) has the molecular formula C20H24BrN3O4S and a molecular weight of 482.40 g/mol. Its IUPAC name is N-[4-[3-[(4-bromophenyl)sulfonylamino]propanoylamino]phenyl]-3-methylbutanamide.
| Compound Name | N-[4-[3-[(4-bromophenyl)sulfonylamino]propanoylamino]phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 33033362 |
| Molecular Formula | C20H24BrN3O4S |
| Molecular Weight | 482.40 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | N-[4-[3-[(4-bromophenyl)sulfonylamino]propanoylamino]phenyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)Nc1ccc(NC(=O)CCNS(=O)(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C20H24BrN3O4S/c1-14(2)13-20(26)24-17-7-5-16(6-8-17)23-19(25)11-12-22-29(27,28)18-9-3-15(21)4-10-18/h3-10,14,22H,11-13H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | QFMARZQIEOUHJO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |