C13H17F3N2O3S — CID 9474697
3-methyl-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]butanamide (PubChem CID 9474697) has the molecular formula C13H17F3N2O3S and a molecular weight of 338.35 g/mol. Its IUPAC name is 3-methyl-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]butanamide.
| Compound Name | 3-methyl-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]butanamide |
|---|---|
| PubChem CID | 9474697 |
| Molecular Formula | C13H17F3N2O3S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 3-methyl-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]butanamide |
| SMILES | CC(C)CC(=O)Nc1ccc(S(=O)(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H17F3N2O3S/c1-9(2)7-12(19)18-10-3-5-11(6-4-10)22(20,21)17-8-13(14,15)16/h3-6,9,17H,7-8H2,1-2H3,(H,18,19) |
| InChIKey | CUSQENKAGYBKQC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |