C19H21F3N2O3S — CID 9474816
4-(2-methylpropyl)-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]benzamide (PubChem CID 9474816) has the molecular formula C19H21F3N2O3S and a molecular weight of 414.45 g/mol. Its IUPAC name is 4-(2-methylpropyl)-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]benzamide.
| Compound Name | 4-(2-methylpropyl)-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 9474816 |
| Molecular Formula | C19H21F3N2O3S |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 4-(2-methylpropyl)-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]benzamide |
| SMILES | CC(C)Cc1ccc(C(=O)Nc2ccc(S(=O)(=O)NCC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H21F3N2O3S/c1-13(2)11-14-3-5-15(6-4-14)18(25)24-16-7-9-17(10-8-16)28(26,27)23-12-19(20,21)22/h3-10,13,23H,11-12H2,1-2H3,(H,24,25) |
| InChIKey | SDRXGOONVYKTAR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |