C18H15F3N4O3S — CID 26425964
4-pyrazol-1-yl-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]benzamide (PubChem CID 26425964) has the molecular formula C18H15F3N4O3S and a molecular weight of 424.40 g/mol. Its IUPAC name is 4-pyrazol-1-yl-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]benzamide.
| Compound Name | 4-pyrazol-1-yl-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 26425964 |
| Molecular Formula | C18H15F3N4O3S |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 4-pyrazol-1-yl-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)NCC(F)(F)F)cc1)c1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C18H15F3N4O3S/c19-18(20,21)12-23-29(27,28)16-8-4-14(5-9-16)24-17(26)13-2-6-15(7-3-13)25-11-1-10-22-25/h1-11,23H,12H2,(H,24,26) |
| InChIKey | ILQTUBFQUOKEKE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |