C19H15F3N2O3S — CID 9474695
N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]naphthalene-2-carboxamide (PubChem CID 9474695) has the molecular formula C19H15F3N2O3S and a molecular weight of 408.40 g/mol. Its IUPAC name is N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]naphthalene-2-carboxamide.
| Compound Name | N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 9474695 |
| Molecular Formula | C19H15F3N2O3S |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]naphthalene-2-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)NCC(F)(F)F)cc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H15F3N2O3S/c20-19(21,22)12-23-28(26,27)17-9-7-16(8-10-17)24-18(25)15-6-5-13-3-1-2-4-14(13)11-15/h1-11,23H,12H2,(H,24,25) |
| InChIKey | QNGBNYWBNRLKEJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |